C12H20 — CID 91355229
5-prop-2-enylnona-1,3-diene (PubChem CID 91355229) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 5-prop-2-enylnona-1,3-diene.
| Compound Name | 5-prop-2-enylnona-1,3-diene |
|---|---|
| PubChem CID | 91355229 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 5-prop-2-enylnona-1,3-diene |
| SMILES | C=CC=CC(CC=C)CCCC |
| InChI | InChI=1S/C12H20/c1-4-7-10-12(9-6-3)11-8-5-2/h4,6-7,10,12H,1,3,5,8-9,11H2,2H3 |
| InChIKey | OJTSGLZNRCKHGL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|