C13H22O — CID 134982558
6-prop-2-enyldeca-3,4-dien-2-ol (PubChem CID 134982558) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 6-prop-2-enyldeca-3,4-dien-2-ol.
| Compound Name | 6-prop-2-enyldeca-3,4-dien-2-ol |
|---|---|
| PubChem CID | 134982558 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 6-prop-2-enyldeca-3,4-dien-2-ol |
| SMILES | C=CCC(C=C=CC(C)O)CCCC |
| InChI | InChI=1S/C13H22O/c1-4-6-10-13(8-5-2)11-7-9-12(3)14/h5,9,11-14H,2,4,6,8,10H2,1,3H3 |
| InChIKey | NVJYBWPZGUAGHN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|