C16H31N — CID 174255634
(4Z,6Z)-3-butyl-10-methylundeca-4,6-dien-1-amine (PubChem CID 174255634) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is (4Z,6Z)-3-butyl-10-methylundeca-4,6-dien-1-amine.
| Compound Name | (4Z,6Z)-3-butyl-10-methylundeca-4,6-dien-1-amine |
|---|---|
| PubChem CID | 174255634 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (4Z,6Z)-3-butyl-10-methylundeca-4,6-dien-1-amine |
| SMILES | CCCCC(/C=C\C=C/CCC(C)C)CCN |
| InChI | InChI=1S/C16H31N/c1-4-5-11-16(13-14-17)12-9-7-6-8-10-15(2)3/h6-7,9,12,15-16H,4-5,8,10-11,13-14,17H2,1-3H3/b7-6-,12-9- |
| InChIKey | CGWPZUJJENMOJS-OMBMMOEUSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|