C10H18O4 — CID 102151164
(2R,4aR,8aS)-2,4a-dimethoxy-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran (PubChem CID 102151164) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2R,4aR,8aS)-2,4a-dimethoxy-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran.
| Compound Name | (2R,4aR,8aS)-2,4a-dimethoxy-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran |
|---|---|
| PubChem CID | 102151164 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (2R,4aR,8aS)-2,4a-dimethoxy-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran |
| SMILES | CO[C@H]1CC[C@@]2(OC)OCCC[C@@H]2O1 |
| InChI | InChI=1S/C10H18O4/c1-11-9-5-6-10(12-2)8(14-9)4-3-7-13-10/h8-9H,3-7H2,1-2H3/t8-,9+,10+/m0/s1 |
| InChIKey | DYAOJEOQCFCVEH-IVZWLZJFSA-N |
| XLogP | 1.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |