C26H27NO4 — CID 102154790
dimethyl 1-benzyl-2-methyl-5-(2-methyl-1-phenylprop-2-enyl)pyrrole-3,4-dicarboxylate (PubChem CID 102154790) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is dimethyl 1-benzyl-2-methyl-5-(2-methyl-1-phenylprop-2-enyl)pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-2-methyl-5-(2-methyl-1-phenylprop-2-enyl)pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102154790 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | dimethyl 1-benzyl-2-methyl-5-(2-methyl-1-phenylprop-2-enyl)pyrrole-3,4-dicarboxylate |
| SMILES | C=C(C)C(c1ccccc1)c1c(C(=O)OC)c(C(=O)OC)c(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c1-17(2)21(20-14-10-7-11-15-20)24-23(26(29)31-5)22(25(28)30-4)18(3)27(24)16-19-12-8-6-9-13-19/h6-15,21H,1,16H2,2-5H3 |
| InChIKey | XGGUFPYENDNXJF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|