C24H19NO5 — CID 102154957
(3R,4'R)-3',4'-bis(4-methoxyphenyl)spiro[1-benzofuran-3,5'-4H-1,2-oxazole]-2-one (PubChem CID 102154957) has the molecular formula C24H19NO5 and a molecular weight of 401.42 g/mol. Its IUPAC name is (3R,4'R)-3',4'-bis(4-methoxyphenyl)spiro[1-benzofuran-3,5'-4H-1,2-oxazole]-2-one.
| Compound Name | (3R,4'R)-3',4'-bis(4-methoxyphenyl)spiro[1-benzofuran-3,5'-4H-1,2-oxazole]-2-one |
|---|---|
| PubChem CID | 102154957 |
| Molecular Formula | C24H19NO5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (3R,4'R)-3',4'-bis(4-methoxyphenyl)spiro[1-benzofuran-3,5'-4H-1,2-oxazole]-2-one |
| SMILES | COc1ccc(C2=NO[C@]3(C(=O)Oc4ccccc43)[C@@H]2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H19NO5/c1-27-17-11-7-15(8-12-17)21-22(16-9-13-18(28-2)14-10-16)25-30-24(21)19-5-3-4-6-20(19)29-23(24)26/h3-14,21H,1-2H3/t21-,24+/m1/s1 |
| InChIKey | XJLAMBLYFSDZSH-QPPBQGQZSA-N |
| XLogP | 4.04 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|