C36H28Cl4N2O5 — CID 139066110
(1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-bis(4-methoxyphenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one (PubChem CID 139066110) has the molecular formula C36H28Cl4N2O5 and a molecular weight of 710.44 g/mol. Its IUPAC name is (1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-bis(4-methoxyphenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one.
| Compound Name | (1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-bis(4-methoxyphenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
|---|---|
| PubChem CID | 139066110 |
| Molecular Formula | C36H28Cl4N2O5 |
| Molecular Weight | 710.44 g/mol |
| Exact Mass | 708.08 |
| IUPAC Name | (1S,5S,7S,11S)-2,10-bis(2,6-dichlorophenyl)-1,11-bis(4-methoxyphenyl)-4,8-dioxa-3,9-diazadispiro[4.1.47.35]tetradeca-2,9-dien-6-one |
| SMILES | COc1ccc([C@H]2C(c3c(Cl)cccc3Cl)=NO[C@@]23CCC[C@@]2(ON=C(c4c(Cl)cccc4Cl)[C@@H]2c2ccc(OC)cc2)C3=O)cc1 |
| InChI | InChI=1S/C36H28Cl4N2O5/c1-44-22-14-10-20(11-15-22)30-32(28-24(37)6-3-7-25(28)38)41-46-35(30)18-5-19-36(34(35)43)31(21-12-16-23(45-2)17-13-21)33(42-47-36)29-26(39)8-4-9-27(29)40/h3-4,6-17,30-31H,5,18-19H2,1-2H3/t30-,31-,35-,36-/m0/s1 |
| InChIKey | XPEFXIIIODHKNY-LGPNGYOUSA-N |
| XLogP | 9.28 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.44 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |