C19H40O5Si2 — CID 102156325
(1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylideneoxolan-2-yl]ethane-1,2-diol (PubChem CID 102156325) has the molecular formula C19H40O5Si2 and a molecular weight of 404.70 g/mol. Its IUPAC name is (1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylideneoxolan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylideneoxolan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 102156325 |
| Molecular Formula | C19H40O5Si2 |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methylideneoxolan-2-yl]ethane-1,2-diol |
| SMILES | C=C1O[C@@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O5Si2/c1-13-15(23-25(8,9)18(2,3)4)17(16(22-13)14(21)12-20)24-26(10,11)19(5,6)7/h14-17,20-21H,1,12H2,2-11H3/t14-,15+,16+,17-/m1/s1 |
| InChIKey | DJJCAMJKQGJLCR-LTIDMASMSA-N |
| XLogP | 4.03 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|