C12H18O5 — CID 102157027
[(1S)-1-[(4R,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-2-oxoethyl] acetate (PubChem CID 102157027) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is [(1S)-1-[(4R,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-2-oxoethyl] acetate.
| Compound Name | [(1S)-1-[(4R,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 102157027 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [(1S)-1-[(4R,5S)-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]-2-oxoethyl] acetate |
| SMILES | C=CC[C@@H]1OC(C)(C)O[C@H]1[C@@H](C=O)OC(C)=O |
| InChI | InChI=1S/C12H18O5/c1-5-6-9-11(17-12(3,4)16-9)10(7-13)15-8(2)14/h5,7,9-11H,1,6H2,2-4H3/t9-,10+,11+/m0/s1 |
| InChIKey | QMPIPHDQRGPWBP-HBNTYKKESA-N |
| XLogP | 1.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|