C18H30O6 — CID 11359823
[(2R)-pent-4-en-2-yl] (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate (PubChem CID 11359823) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [(2R)-pent-4-en-2-yl] (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate.
| Compound Name | [(2R)-pent-4-en-2-yl] (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 11359823 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(2R)-pent-4-en-2-yl] (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
| SMILES | C=CCC[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@H]1C(=O)O[C@H](C)CC=C |
| InChI | InChI=1S/C18H30O6/c1-8-10-12-14-15(16(19)22-13(3)11-9-2)24-18(5,21-7)17(4,20-6)23-14/h8-9,13-15H,1-2,10-12H2,3-7H3/t13-,14+,15-,17-,18-/m1/s1 |
| InChIKey | BZSVZMOUNPQTSN-JAPOXJDPSA-N |
| XLogP | 2.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|