C16H26O6 — CID 11151165
(2R,3R,4aR,7R,9E,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one (PubChem CID 11151165) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2R,3R,4aR,7R,9E,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one.
| Compound Name | (2R,3R,4aR,7R,9E,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one |
|---|---|
| PubChem CID | 11151165 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2R,3R,4aR,7R,9E,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one |
| SMILES | CO[C@]1(C)O[C@H]2CC/C=C/C[C@@H](C)OC(=O)[C@@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/C16H26O6/c1-11-9-7-6-8-10-12-13(14(17)20-11)22-16(3,19-5)15(2,18-4)21-12/h6-7,11-13H,8-10H2,1-5H3/b7-6+/t11-,12+,13-,15-,16-/m1/s1 |
| InChIKey | DOUQJDFJBAWRNO-BWOSYCGISA-N |
| XLogP | 2.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|