About 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate
6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate (PubChem CID 176644765) has the molecular formula C16H28O5
and a molecular weight of 300.39 g/mol. Its IUPAC name is 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate.
Molecular Properties
| Compound Name | 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate |
| PubChem CID | 176644765 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate |
| SMILES | CC/C=C\CCOCOCCCCCCOC(=O)C1CO1 |
| InChI | InChI=1S/C16H28O5/c1-2-3-4-7-10-18-14-19-11-8-5-6-9-12-20-16(17)15-13-21-15/h3-4,15H,2,5-14H2,1H3/b4-3- |
| InChIKey | PHUNRKBCQKOKSA-ARJAWSKDSA-N |
| XLogP | 2.84 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate?
The IUPAC name of 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate (CID 176644765) is 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate.
What is the SMILES notation for 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate?
The canonical SMILES for 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate is CC/C=C\CCOCOCCCCCCOC(=O)C1CO1.
What is the InChIKey of 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate?
The InChIKey is PHUNRKBCQKOKSA-ARJAWSKDSA-N. The full InChI is InChI=1S/C16H28O5/c1-2-3-4-7-10-18-14-19-11-8-5-6-9-12-20-16(17)15-13-21-15/h3-4,15H,2,5-14H2,1H3/b4-3-.
What are the key properties of 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate?
6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate has a molecular weight of 300.39 g/mol, XLogP of 2.84, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(Z)-hex-3-enoxy]methoxy]hexyl oxirane-2-carboxylate is sourced from PubChem (CID 176644765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).