C48H78O18 — CID 139063048
(2R,3R,4aR,7R,9Z,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one (PubChem CID 139063048) has the molecular formula C48H78O18 and a molecular weight of 943.13 g/mol. Its IUPAC name is (2R,3R,4aR,7R,9Z,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one.
| Compound Name | (2R,3R,4aR,7R,9Z,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one |
|---|---|
| PubChem CID | 139063048 |
| Molecular Formula | C48H78O18 |
| Molecular Weight | 943.13 g/mol |
| Exact Mass | 942.52 |
| IUPAC Name | (2R,3R,4aR,7R,9Z,12aS)-2,3-dimethoxy-2,3,7-trimethyl-4a,7,8,11,12,12a-hexahydro-[1,4]dioxino[2,3-c]oxecin-5-one |
| SMILES | CO[C@]1(C)O[C@H]2CC/C=C\C[C@@H](C)OC(=O)[C@@H]2O[C@@]1(C)OC.CO[C@]1(C)O[C@H]2CC/C=C\C[C@@H](C)OC(=O)[C@@H]2O[C@@]1(C)OC.CO[C@]1(C)O[C@H]2CC/C=C\C[C@@H](C)OC(=O)[C@@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/3C16H26O6/c3*1-11-9-7-6-8-10-12-13(14(17)20-11)22-16(3,19-5)15(2,18-4)21-12/h3*6-7,11-13H,8-10H2,1-5H3/b3*7-6-/t3*11-,12+,13-,15-,16-/m111/s1 |
| InChIKey | ICPCCQDMCBBPJG-AOWXRSOFSA-N |
| XLogP | 6.50 |
| TPSA | 189.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.13 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|