C32H52O12 — CID 11399433
(1R,4R,6E,10S,12R,13R,15R,18R,20E,24S,26R,27R)-12,13,26,27-tetramethoxy-4,12,13,18,26,27-hexamethyl-3,11,14,17,25,28-hexaoxatricyclo[22.4.0.010,15]octacosa-6,20-diene-2,16-dione (PubChem CID 11399433) has the molecular formula C32H52O12 and a molecular weight of 628.76 g/mol. Its IUPAC name is (1R,4R,6E,10S,12R,13R,15R,18R,20E,24S,26R,27R)-12,13,26,27-tetramethoxy-4,12,13,18,26,27-hexamethyl-3,11,14,17,25,28-hexaoxatricyclo[22.4.0.010,15]octacosa-6,20-diene-2,16-dione.
| Compound Name | (1R,4R,6E,10S,12R,13R,15R,18R,20E,24S,26R,27R)-12,13,26,27-tetramethoxy-4,12,13,18,26,27-hexamethyl-3,11,14,17,25,28-hexaoxatricyclo[22.4.0.010,15]octacosa-6,20-diene-2,16-dione |
|---|---|
| PubChem CID | 11399433 |
| Molecular Formula | C32H52O12 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | (1R,4R,6E,10S,12R,13R,15R,18R,20E,24S,26R,27R)-12,13,26,27-tetramethoxy-4,12,13,18,26,27-hexamethyl-3,11,14,17,25,28-hexaoxatricyclo[22.4.0.010,15]octacosa-6,20-diene-2,16-dione |
| SMILES | CO[C@]1(C)O[C@H]2CC/C=C/C[C@@H](C)OC(=O)[C@@H]3O[C@@](C)(OC)[C@](C)(OC)O[C@H]3CC/C=C/C[C@@H](C)OC(=O)[C@@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/C32H52O12/c1-21-17-13-11-15-19-24-26(44-32(6,38-10)30(4,36-8)42-24)28(34)40-22(2)18-14-12-16-20-23-25(27(33)39-21)43-31(5,37-9)29(3,35-7)41-23/h11-14,21-26H,15-20H2,1-10H3/b13-11+,14-12+/t21-,22-,23+,24+,25-,26-,29-,30-,31-,32-/m1/s1 |
| InChIKey | WMQIWKMLMADFDU-FKJBLKFKSA-N |
| XLogP | 4.33 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|