C14H24O6 — CID 11335215
methyl (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate (PubChem CID 11335215) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate.
| Compound Name | methyl (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 11335215 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | methyl (2R,3S,5R,6R)-3-but-3-enyl-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carboxylate |
| SMILES | C=CCC[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@H]1C(=O)OC |
| InChI | InChI=1S/C14H24O6/c1-7-8-9-10-11(12(15)16-4)20-14(3,18-6)13(2,17-5)19-10/h7,10-11H,1,8-9H2,2-6H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | GQQUAAUFOJSOII-OIMNJJJWSA-N |
| XLogP | 1.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|