C22H28O5 — CID 102157362
[(1R,5R,8R,9R,10S,12R,14S)-5-formyl-10-hydroxy-5-methyl-11-methylidene-15-oxo-8-pentacyclo[10.3.2.01,6.09,14.09,16]heptadecanyl] acetate (PubChem CID 102157362) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(1R,5R,8R,9R,10S,12R,14S)-5-formyl-10-hydroxy-5-methyl-11-methylidene-15-oxo-8-pentacyclo[10.3.2.01,6.09,14.09,16]heptadecanyl] acetate.
| Compound Name | [(1R,5R,8R,9R,10S,12R,14S)-5-formyl-10-hydroxy-5-methyl-11-methylidene-15-oxo-8-pentacyclo[10.3.2.01,6.09,14.09,16]heptadecanyl] acetate |
|---|---|
| PubChem CID | 102157362 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | [(1R,5R,8R,9R,10S,12R,14S)-5-formyl-10-hydroxy-5-methyl-11-methylidene-15-oxo-8-pentacyclo[10.3.2.01,6.09,14.09,16]heptadecanyl] acetate |
| SMILES | C=C1[C@@H]2CC3[C@]45CCC[C@@](C)(C=O)C4C[C@@H](OC(C)=O)[C@]3([C@H](C2)C5=O)[C@H]1O |
| InChI | InChI=1S/C22H28O5/c1-11-13-7-14-19(26)21-6-4-5-20(3,10-23)15(21)9-17(27-12(2)24)22(14,18(11)25)16(21)8-13/h10,13-18,25H,1,4-9H2,2-3H3/t13-,14+,15?,16?,17+,18-,20-,21-,22+/m0/s1 |
| InChIKey | ZDNMDOAXDDWWQL-RPTHVZPXSA-N |
| XLogP | 2.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|