C11H18Cl3NO — CID 102157547
[(3R,4R)-4-methyloct-1-en-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 102157547) has the molecular formula C11H18Cl3NO and a molecular weight of 286.63 g/mol. Its IUPAC name is [(3R,4R)-4-methyloct-1-en-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4R)-4-methyloct-1-en-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102157547 |
| Molecular Formula | C11H18Cl3NO |
| Molecular Weight | 286.63 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [(3R,4R)-4-methyloct-1-en-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\O[C@H](C=C)[C@H](C)CCCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO/c1-4-6-7-8(3)9(5-2)16-10(15)11(12,13)14/h5,8-9,15H,2,4,6-7H2,1,3H3/b15-10-/t8-,9-/m1/s1 |
| InChIKey | YRZJAHUUHTXPJE-WWRJAXQESA-N |
| XLogP | 4.73 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|