C10H16Cl3NO2 — CID 102157544
[(3R,4R)-6-methoxy-4-methylhex-1-en-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 102157544) has the molecular formula C10H16Cl3NO2 and a molecular weight of 288.60 g/mol. Its IUPAC name is [(3R,4R)-6-methoxy-4-methylhex-1-en-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4R)-6-methoxy-4-methylhex-1-en-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 102157544 |
| Molecular Formula | C10H16Cl3NO2 |
| Molecular Weight | 288.60 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | [(3R,4R)-6-methoxy-4-methylhex-1-en-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\O[C@H](C=C)[C@H](C)CCOC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H16Cl3NO2/c1-4-8(7(2)5-6-15-3)16-9(14)10(11,12)13/h4,7-8,14H,1,5-6H2,2-3H3/b14-9-/t7-,8-/m1/s1 |
| InChIKey | NSTHHWBVKWQABQ-LIDUYEILSA-N |
| XLogP | 3.58 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|