C8H12Cl3NO — CID 15308862
hex-1-en-3-yl 2,2,2-trichloroethanimidate (PubChem CID 15308862) has the molecular formula C8H12Cl3NO and a molecular weight of 244.55 g/mol. Its IUPAC name is hex-1-en-3-yl 2,2,2-trichloroethanimidate.
| Compound Name | hex-1-en-3-yl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 15308862 |
| Molecular Formula | C8H12Cl3NO |
| Molecular Weight | 244.55 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | hex-1-en-3-yl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC(C=C)CCC)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl3NO/c1-3-5-6(4-2)13-7(12)8(9,10)11/h4,6,12H,2-3,5H2,1H3/b12-7- |
| InChIKey | VQMPPJRTDIZSJF-GHXNOFRVSA-N |
| XLogP | 3.71 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|