C28H36NO4P — CID 102158744
butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-(furan-2-yl)butanoate (PubChem CID 102158744) has the molecular formula C28H36NO4P and a molecular weight of 481.57 g/mol. Its IUPAC name is butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-(furan-2-yl)butanoate.
| Compound Name | butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-(furan-2-yl)butanoate |
|---|---|
| PubChem CID | 102158744 |
| Molecular Formula | C28H36NO4P |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-(furan-2-yl)butanoate |
| SMILES | CCCCOC(=O)CC(C)(NP(=O)(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1)c1ccco1 |
| InChI | InChI=1S/C28H36NO4P/c1-7-8-11-33-27(30)19-28(6,26-10-9-12-32-26)29-34(31,24-15-20(2)13-21(3)16-24)25-17-22(4)14-23(5)18-25/h9-10,12-18H,7-8,11,19H2,1-6H3,(H,29,31) |
| InChIKey | BVZRPEHWJKCTMS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|