C34H40NO3P — CID 102158743
butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-naphthalen-2-ylbutanoate (PubChem CID 102158743) has the molecular formula C34H40NO3P and a molecular weight of 541.67 g/mol. Its IUPAC name is butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-naphthalen-2-ylbutanoate.
| Compound Name | butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-naphthalen-2-ylbutanoate |
|---|---|
| PubChem CID | 102158743 |
| Molecular Formula | C34H40NO3P |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | butyl 3-[bis(3,5-dimethylphenyl)phosphorylamino]-3-naphthalen-2-ylbutanoate |
| SMILES | CCCCOC(=O)CC(C)(NP(=O)(c1cc(C)cc(C)c1)c1cc(C)cc(C)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H40NO3P/c1-7-8-15-38-33(36)23-34(6,30-14-13-28-11-9-10-12-29(28)22-30)35-39(37,31-18-24(2)16-25(3)19-31)32-20-26(4)17-27(5)21-32/h9-14,16-22H,7-8,15,23H2,1-6H3,(H,35,37) |
| InChIKey | LFMXXSBUOLYASX-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|