C18H23NO2 — CID 117049792
ethyl 5-amino-2-methyl-2-naphthalen-2-ylpentanoate (PubChem CID 117049792) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is ethyl 5-amino-2-methyl-2-naphthalen-2-ylpentanoate.
| Compound Name | ethyl 5-amino-2-methyl-2-naphthalen-2-ylpentanoate |
|---|---|
| PubChem CID | 117049792 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl 5-amino-2-methyl-2-naphthalen-2-ylpentanoate |
| SMILES | CCOC(=O)C(C)(CCCN)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H23NO2/c1-3-21-17(20)18(2,11-6-12-19)16-10-9-14-7-4-5-8-15(14)13-16/h4-5,7-10,13H,3,6,11-12,19H2,1-2H3 |
| InChIKey | MVEJYOMCPSAUBQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |