C24H30N2O2 — CID 67662616
ethyl 5-amino-2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methylpentanoate (PubChem CID 67662616) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is ethyl 5-amino-2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methylpentanoate.
| Compound Name | ethyl 5-amino-2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methylpentanoate |
|---|---|
| PubChem CID | 67662616 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | ethyl 5-amino-2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methylpentanoate |
| SMILES | CCOC(=O)C(C)(CCCN)c1ccc2c(ccn2-c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C24H30N2O2/c1-5-28-23(27)24(4,10-6-11-25)20-7-8-22-19(16-20)9-12-26(22)21-14-17(2)13-18(3)15-21/h7-9,12-16H,5-6,10-11,25H2,1-4H3 |
| InChIKey | ZRBOUCGMNXHUNA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |