C27H34N2O4 — CID 67665555
2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 67665555) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | 2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 67665555 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2-[1-(3,5-dimethylphenyl)indol-5-yl]-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | Cc1cc(C)cc(-n2ccc3cc(C(C)(CCCNC(=O)OC(C)(C)C)C(=O)O)ccc32)c1 |
| InChI | InChI=1S/C27H34N2O4/c1-18-14-19(2)16-22(15-18)29-13-10-20-17-21(8-9-23(20)29)27(6,24(30)31)11-7-12-28-25(32)33-26(3,4)5/h8-10,13-17H,7,11-12H2,1-6H3,(H,28,32)(H,30,31) |
| InChIKey | BQIIYBSVPNOFSS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|