C18H13N3O3S2 — CID 10215918
3-[2-(pyridin-2-ylsulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one (PubChem CID 10215918) has the molecular formula C18H13N3O3S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-[2-(pyridin-2-ylsulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one.
| Compound Name | 3-[2-(pyridin-2-ylsulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10215918 |
| Molecular Formula | C18H13N3O3S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 3-[2-(pyridin-2-ylsulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1csc(CS(=O)(=O)c2ccccn2)n1 |
| InChI | InChI=1S/C18H13N3O3S2/c22-18-13(9-12-5-1-2-6-14(12)21-18)15-10-25-16(20-15)11-26(23,24)17-7-3-4-8-19-17/h1-10H,11H2,(H,21,22) |
| InChIKey | OHPFNMNHNRGIBV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |