C16H10N2OS2 — CID 10286404
3-(2-thiophen-3-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one (PubChem CID 10286404) has the molecular formula C16H10N2OS2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-(2-thiophen-3-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one.
| Compound Name | 3-(2-thiophen-3-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10286404 |
| Molecular Formula | C16H10N2OS2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-(2-thiophen-3-yl-1,3-thiazol-4-yl)-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C16H10N2OS2/c19-15-12(7-10-3-1-2-4-13(10)17-15)14-9-21-16(18-14)11-5-6-20-8-11/h1-9H,(H,17,19) |
| InChIKey | NWOJZWHRHFCZST-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |