C19H14N2O3S2 — CID 10287269
3-[2-(benzenesulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one (PubChem CID 10287269) has the molecular formula C19H14N2O3S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-[2-(benzenesulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one.
| Compound Name | 3-[2-(benzenesulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10287269 |
| Molecular Formula | C19H14N2O3S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-[2-(benzenesulfonylmethyl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2cc1-c1csc(CS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C19H14N2O3S2/c22-19-15(10-13-6-4-5-9-16(13)21-19)17-11-25-18(20-17)12-26(23,24)14-7-2-1-3-8-14/h1-11H,12H2,(H,21,22) |
| InChIKey | DENJPOISBSHUGX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |