C19H14N2O2S2 — CID 142273169
3-[4-(4-methylsulfinylphenyl)-1,3-thiazol-2-yl]-1H-quinolin-2-one (PubChem CID 142273169) has the molecular formula C19H14N2O2S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-[4-(4-methylsulfinylphenyl)-1,3-thiazol-2-yl]-1H-quinolin-2-one.
| Compound Name | 3-[4-(4-methylsulfinylphenyl)-1,3-thiazol-2-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142273169 |
| Molecular Formula | C19H14N2O2S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 3-[4-(4-methylsulfinylphenyl)-1,3-thiazol-2-yl]-1H-quinolin-2-one |
| SMILES | CS(=O)c1ccc(-c2csc(-c3cc4ccccc4[nH]c3=O)n2)cc1 |
| InChI | InChI=1S/C19H14N2O2S2/c1-25(23)14-8-6-12(7-9-14)17-11-24-19(21-17)15-10-13-4-2-3-5-16(13)20-18(15)22/h2-11H,1H3,(H,20,22) |
| InChIKey | LZGMRMZXKXLZLK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |