C17H11N3O2S — CID 135443299
3-[2-(6-oxo-1H-pyridin-3-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one (PubChem CID 135443299) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-[2-(6-oxo-1H-pyridin-3-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one.
| Compound Name | 3-[2-(6-oxo-1H-pyridin-3-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135443299 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-[2-(6-oxo-1H-pyridin-3-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
| SMILES | O=c1ccc(-c2nc(-c3cc4ccccc4[nH]c3=O)cs2)c[nH]1 |
| InChI | InChI=1S/C17H11N3O2S/c21-15-6-5-11(8-18-15)17-20-14(9-23-17)12-7-10-3-1-2-4-13(10)19-16(12)22/h1-9H,(H,18,21)(H,19,22) |
| InChIKey | XADXQGVHDABCFJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |