C20H16N2O3S2 — CID 142273118
3-[2-(benzenesulfinylmethyl)-1,3-thiazol-4-yl]-7-methoxy-1H-quinolin-2-one (PubChem CID 142273118) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-[2-(benzenesulfinylmethyl)-1,3-thiazol-4-yl]-7-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[2-(benzenesulfinylmethyl)-1,3-thiazol-4-yl]-7-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142273118 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 3-[2-(benzenesulfinylmethyl)-1,3-thiazol-4-yl]-7-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2cc(-c3csc(CS(=O)c4ccccc4)n3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H16N2O3S2/c1-25-14-8-7-13-9-16(20(23)22-17(13)10-14)18-11-26-19(21-18)12-27(24)15-5-3-2-4-6-15/h2-11H,12H2,1H3,(H,22,23) |
| InChIKey | RFAWJMZVOHSDNA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |