C14H11NS — CID 102160220
5-methyl-6-phenylthieno[3,2-b]pyridine (PubChem CID 102160220) has the molecular formula C14H11NS and a molecular weight of 225.32 g/mol. Its IUPAC name is 5-methyl-6-phenylthieno[3,2-b]pyridine.
| Compound Name | 5-methyl-6-phenylthieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 102160220 |
| Molecular Formula | C14H11NS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 5-methyl-6-phenylthieno[3,2-b]pyridine |
| SMILES | Cc1nc2ccsc2cc1-c1ccccc1 |
| InChI | InChI=1S/C14H11NS/c1-10-12(11-5-3-2-4-6-11)9-14-13(15-10)7-8-16-14/h2-9H,1H3 |
| InChIKey | SEKHQSWEQICONC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |