C25H34O2S — CID 102160364
(2S,3S,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2-phenylsulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 102160364) has the molecular formula C25H34O2S and a molecular weight of 398.61 g/mol. Its IUPAC name is (2S,3S,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2-phenylsulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (2S,3S,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2-phenylsulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 102160364 |
| Molecular Formula | C25H34O2S |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (2S,3S,5S,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-2-phenylsulfanyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12C[C@H](Sc3ccccc3)[C@@H](O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H34O2S/c1-24-13-12-20-18(19(24)10-11-23(24)27)9-8-16-14-21(26)22(15-25(16,20)2)28-17-6-4-3-5-7-17/h3-7,16,18-22,26H,8-15H2,1-2H3/t16-,18-,19-,20-,21-,22-,24-,25-/m0/s1 |
| InChIKey | KPLYQYDIKBBPEQ-QNKZNIKJSA-N |
| XLogP | 5.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |