C20H32O2 — CID 102160638
(1S,6R)-3-methyl-6-[(Z,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-ol (PubChem CID 102160638) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,6R)-3-methyl-6-[(Z,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-ol.
| Compound Name | (1S,6R)-3-methyl-6-[(Z,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 102160638 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,6R)-3-methyl-6-[(Z,2S)-4-[(1R,2S,3S,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]but-3-en-2-yl]cyclohex-2-en-1-ol |
| SMILES | CC1=C[C@@H](O)[C@@H]([C@@H](C)/C=C\[C@H]2[C@H](C)[C@]3(C)CC[C@@]2(C)O3)CC1 |
| InChI | InChI=1S/C20H32O2/c1-13-6-8-16(18(21)12-13)14(2)7-9-17-15(3)19(4)10-11-20(17,5)22-19/h7,9,12,14-18,21H,6,8,10-11H2,1-5H3/b9-7-/t14-,15-,16+,17-,18+,19-,20+/m0/s1 |
| InChIKey | LGOUFPAXYMCOPF-HMLIQHLUSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|