C28H32F9NO2 — CID 102160684
N-[4-[(2S)-2-methylbutoxy]phenyl]-1-[4-(7,7,8,8,9,9,10,10,10-nonafluorodecoxy)phenyl]methanimine (PubChem CID 102160684) has the molecular formula C28H32F9NO2 and a molecular weight of 585.55 g/mol. Its IUPAC name is N-[4-[(2S)-2-methylbutoxy]phenyl]-1-[4-(7,7,8,8,9,9,10,10,10-nonafluorodecoxy)phenyl]methanimine.
| Compound Name | N-[4-[(2S)-2-methylbutoxy]phenyl]-1-[4-(7,7,8,8,9,9,10,10,10-nonafluorodecoxy)phenyl]methanimine |
|---|---|
| PubChem CID | 102160684 |
| Molecular Formula | C28H32F9NO2 |
| Molecular Weight | 585.55 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | N-[4-[(2S)-2-methylbutoxy]phenyl]-1-[4-(7,7,8,8,9,9,10,10,10-nonafluorodecoxy)phenyl]methanimine |
| SMILES | CC[C@H](C)COc1ccc(/N=C/c2ccc(OCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H32F9NO2/c1-3-20(2)19-40-24-14-10-22(11-15-24)38-18-21-8-12-23(13-9-21)39-17-7-5-4-6-16-25(29,30)26(31,32)27(33,34)28(35,36)37/h8-15,18,20H,3-7,16-17,19H2,1-2H3/b38-18+/t20-/m0/s1 |
| InChIKey | OABZBRPBWOBJQL-NGOYJHRKSA-N |
| XLogP | 9.66 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.55 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|