C10H9NO2 — CID 102161636
(1S,5R,6R)-5-hydroxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile (PubChem CID 102161636) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is (1S,5R,6R)-5-hydroxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile.
| Compound Name | (1S,5R,6R)-5-hydroxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile |
|---|---|
| PubChem CID | 102161636 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | (1S,5R,6R)-5-hydroxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile |
| SMILES | N#C[C@H]1C[C@@H]2C=CC(=O)[C@@]1(O)C=C2 |
| InChI | InChI=1S/C10H9NO2/c11-6-8-5-7-1-2-9(12)10(8,13)4-3-7/h1-4,7-8,13H,5H2/t7-,8-,10-/m1/s1 |
| InChIKey | CUVYJLXSRRMIJI-NQMVMOMDSA-N |
| XLogP | 0.57 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|