C11H11NO2 — CID 166447248
5-methoxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile (PubChem CID 166447248) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 5-methoxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile.
| Compound Name | 5-methoxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile |
|---|---|
| PubChem CID | 166447248 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 5-methoxy-4-oxobicyclo[3.2.2]nona-2,8-diene-6-carbonitrile |
| SMILES | COC12C=CC(C=CC1=O)CC2C#N |
| InChI | InChI=1S/C11H11NO2/c1-14-11-5-4-8(2-3-10(11)13)6-9(11)7-12/h2-5,8-9H,6H2,1H3 |
| InChIKey | NWDGKIHAANUOPF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|