About 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile
3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile (PubChem CID 166447323) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile.
Molecular Properties
| Compound Name | 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile |
| PubChem CID | 166447323 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile |
| SMILES | COC1=CC2C=CC(CC2C#N)C1=O |
| InChI | InChI=1S/C11H11NO2/c1-14-10-5-7-2-3-8(11(10)13)4-9(7)6-12/h2-3,5,7-9H,4H2,1H3 |
| InChIKey | GQHLFRVEJUQCDR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile?
The IUPAC name of 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile (CID 166447323) is 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile.
What is the SMILES notation for 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile?
The canonical SMILES for 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile is COC1=CC2C=CC(CC2C#N)C1=O.
What is the InChIKey of 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile?
The InChIKey is GQHLFRVEJUQCDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-14-10-5-7-2-3-8(11(10)13)4-9(7)6-12/h2-3,5,7-9H,4H2,1H3.
What are the key properties of 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile?
3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile has a molecular weight of 189.21 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-oxobicyclo[3.2.2]nona-3,8-diene-6-carbonitrile is sourced from PubChem (CID 166447323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).