C62H106O6 — CID 102162843
1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yl (10E,12Z,15Z)-9-cyclopent-3-en-1-yloctadeca-10,12,15-trienoate (PubChem CID 102162843) has the molecular formula C62H106O6 and a molecular weight of 947.52 g/mol. Its IUPAC name is 1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yl (10E,12Z,15Z)-9-cyclopent-3-en-1-yloctadeca-10,12,15-trienoate.
| Compound Name | 1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yl (10E,12Z,15Z)-9-cyclopent-3-en-1-yloctadeca-10,12,15-trienoate |
|---|---|
| PubChem CID | 102162843 |
| Molecular Formula | C62H106O6 |
| Molecular Weight | 947.52 g/mol |
| Exact Mass | 946.80 |
| IUPAC Name | 1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yl (10E,12Z,15Z)-9-cyclopent-3-en-1-yloctadeca-10,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C=C\C(CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC)C1CC=CC1 |
| InChI | InChI=1S/C62H106O6/c1-4-7-10-13-16-18-20-22-24-26-28-30-33-38-43-52-60(63)66-55-59(56-67-61(64)53-44-39-34-31-29-27-25-23-21-19-17-14-11-8-5-2)68-62(65)54-45-40-35-37-42-49-57(58-50-46-47-51-58)48-41-36-32-15-12-9-6-3/h9,12,22-25,32,36,41,46-48,57-59H,4-8,10-11,13-21,26-31,33-35,37-40,42-45,49-56H2,1-3H3/b12-9-,24-22-,25-23-,36-32-,48-41+ |
| InChIKey | CTOYCKCEOMMRGD-OENXGJNRSA-N |
| XLogP | 18.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.52 |
| LogP ≤ 5 | 18.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|