C22H32N2O6S2 — CID 102163028
4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]benzene-1,2-dicarbonitrile (PubChem CID 102163028) has the molecular formula C22H32N2O6S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 102163028 |
| Molecular Formula | C22H32N2O6S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 4,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]benzene-1,2-dicarbonitrile |
| SMILES | COCCOCCOCCSc1cc(C#N)c(C#N)cc1SCCOCCOCCOC |
| InChI | InChI=1S/C22H32N2O6S2/c1-25-3-5-27-7-9-29-11-13-31-21-15-19(17-23)20(18-24)16-22(21)32-14-12-30-10-8-28-6-4-26-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | HMUVHBPYPXEQKP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|