C42H81N10P3 — CID 102163157
[7,11-bis[(tributyl-λ5-phosphanylidene)amino]-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]imino-tributyl-λ5-phosphane (PubChem CID 102163157) has the molecular formula C42H81N10P3 and a molecular weight of 819.10 g/mol. Its IUPAC name is [7,11-bis[(tributyl-λ5-phosphanylidene)amino]-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]imino-tributyl-λ5-phosphane.
| Compound Name | [7,11-bis[(tributyl-λ5-phosphanylidene)amino]-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]imino-tributyl-λ5-phosphane |
|---|---|
| PubChem CID | 102163157 |
| Molecular Formula | C42H81N10P3 |
| Molecular Weight | 819.10 g/mol |
| Exact Mass | 818.59 |
| IUPAC Name | [7,11-bis[(tributyl-λ5-phosphanylidene)amino]-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]imino-tributyl-λ5-phosphane |
| SMILES | CCCCP(CCCC)(CCCC)=NC1=NC2=NC(N=P(CCCC)(CCCC)CCCC)=NC3=NC(N=P(CCCC)(CCCC)CCCC)=NC(=N1)N23 |
| InChI | InChI=1S/C42H81N10P3/c1-10-19-28-53(29-20-11-2,30-21-12-3)49-37-43-40-45-38(50-54(31-22-13-4,32-23-14-5)33-24-15-6)47-42-48-39(46-41(44-37)52(40)42)51-55(34-25-16-7,35-26-17-8)36-27-18-9/h10-36H2,1-9H3 |
| InChIKey | BEEQGJUOJPXTPU-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 114.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.10 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|