C23H37N2O2PS — CID 102013880
(1-oxo-3,6-dihydrothiazin-2-yl)-[2-[(tributyl-λ5-phosphanylidene)amino]phenyl]methanone (PubChem CID 102013880) has the molecular formula C23H37N2O2PS and a molecular weight of 436.60 g/mol. Its IUPAC name is (1-oxo-3,6-dihydrothiazin-2-yl)-[2-[(tributyl-λ5-phosphanylidene)amino]phenyl]methanone.
| Compound Name | (1-oxo-3,6-dihydrothiazin-2-yl)-[2-[(tributyl-λ5-phosphanylidene)amino]phenyl]methanone |
|---|---|
| PubChem CID | 102013880 |
| Molecular Formula | C23H37N2O2PS |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (1-oxo-3,6-dihydrothiazin-2-yl)-[2-[(tributyl-λ5-phosphanylidene)amino]phenyl]methanone |
| SMILES | CCCCP(CCCC)(CCCC)=Nc1ccccc1C(=O)N1CC=CCS1=O |
| InChI | InChI=1S/C23H37N2O2PS/c1-4-7-17-28(18-8-5-2,19-9-6-3)24-22-15-11-10-14-21(22)23(26)25-16-12-13-20-29(25)27/h10-15H,4-9,16-20H2,1-3H3 |
| InChIKey | MLBFAFWEPIESNT-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|