C25H36N3O2P — CID 10623032
3-(1H-indol-3-yl)-1-methyl-4-[(tributyl-λ5-phosphanylidene)amino]pyrrole-2,5-dione (PubChem CID 10623032) has the molecular formula C25H36N3O2P and a molecular weight of 441.56 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-1-methyl-4-[(tributyl-λ5-phosphanylidene)amino]pyrrole-2,5-dione.
| Compound Name | 3-(1H-indol-3-yl)-1-methyl-4-[(tributyl-λ5-phosphanylidene)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10623032 |
| Molecular Formula | C25H36N3O2P |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 3-(1H-indol-3-yl)-1-methyl-4-[(tributyl-λ5-phosphanylidene)amino]pyrrole-2,5-dione |
| SMILES | CCCCP(CCCC)(CCCC)=NC1=C(c2c[nH]c3ccccc23)C(=O)N(C)C1=O |
| InChI | InChI=1S/C25H36N3O2P/c1-5-8-15-31(16-9-6-2,17-10-7-3)27-23-22(24(29)28(4)25(23)30)20-18-26-21-14-12-11-13-19(20)21/h11-14,18,26H,5-10,15-17H2,1-4H3 |
| InChIKey | SKIODVGYZPVSBY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 65.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|