C16H20N4S — CID 4968585
N-butyl-5-(1H-indol-3-yl)-3-methyl-6H-1,3,4-thiadiazin-2-imine (PubChem CID 4968585) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-butyl-5-(1H-indol-3-yl)-3-methyl-6H-1,3,4-thiadiazin-2-imine.
| Compound Name | N-butyl-5-(1H-indol-3-yl)-3-methyl-6H-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 4968585 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-butyl-5-(1H-indol-3-yl)-3-methyl-6H-1,3,4-thiadiazin-2-imine |
| SMILES | CCCC/N=C1\SCC(c2c[nH]c3ccccc23)=NN1C |
| InChI | InChI=1S/C16H20N4S/c1-3-4-9-17-16-20(2)19-15(11-21-16)13-10-18-14-8-6-5-7-12(13)14/h5-8,10,18H,3-4,9,11H2,1-2H3/b17-16- |
| InChIKey | YKAZBCKMNKCLJB-MSUUIHNZSA-N |
| XLogP | 3.71 |
| TPSA | 43.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|