C16H18N2O — CID 5250460
5-(1H-indol-3-yl)-2-pentyl-1,3-oxazole (PubChem CID 5250460) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-2-pentyl-1,3-oxazole.
| Compound Name | 5-(1H-indol-3-yl)-2-pentyl-1,3-oxazole |
|---|---|
| PubChem CID | 5250460 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 5-(1H-indol-3-yl)-2-pentyl-1,3-oxazole |
| SMILES | CCCCCc1ncc(-c2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C16H18N2O/c1-2-3-4-9-16-18-11-15(19-16)13-10-17-14-8-6-5-7-12(13)14/h5-8,10-11,17H,2-4,9H2,1H3 |
| InChIKey | QWBQGSICTTZLHY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|