C17H21N3O — CID 137255750
5-heptan-2-yl-3-(1H-indol-3-yl)-1,2,4-oxadiazole (PubChem CID 137255750) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 5-heptan-2-yl-3-(1H-indol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 5-heptan-2-yl-3-(1H-indol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 137255750 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 5-heptan-2-yl-3-(1H-indol-3-yl)-1,2,4-oxadiazole |
| SMILES | CCCCCC(C)c1nc(-c2c[nH]c3ccccc23)no1 |
| InChI | InChI=1S/C17H21N3O/c1-3-4-5-8-12(2)17-19-16(20-21-17)14-11-18-15-10-7-6-9-13(14)15/h6-7,9-12,18H,3-5,8H2,1-2H3 |
| InChIKey | IHQREBOLELLDFK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|