C17H13FN4S — CID 135512224
N-(2-fluorophenyl)-5-(1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135512224) has the molecular formula C17H13FN4S and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-5-(1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(2-fluorophenyl)-5-(1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135512224 |
| Molecular Formula | C17H13FN4S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-(2-fluorophenyl)-5-(1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Fc1ccccc1/N=C1/NN=C(c2c[nH]c3ccccc23)CS1 |
| InChI | InChI=1S/C17H13FN4S/c18-13-6-2-4-8-15(13)20-17-22-21-16(10-23-17)12-9-19-14-7-3-1-5-11(12)14/h1-9,19H,10H2,(H,20,22) |
| InChIKey | KNIMGDJLDGZDNM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|