C15H21NO6S2 — CID 102163260
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxane-3,4,5-triol (PubChem CID 102163260) has the molecular formula C15H21NO6S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102163260 |
| Molecular Formula | C15H21NO6S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxane-3,4,5-triol |
| SMILES | C=CC(CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)SSc1ccccn1 |
| InChI | InChI=1S/C15H21NO6S2/c1-2-9(23-24-11-5-3-4-6-16-11)8-21-15-14(20)13(19)12(18)10(7-17)22-15/h2-6,9-10,12-15,17-20H,1,7-8H2/t9?,10-,12+,13+,14-,15-/m1/s1 |
| InChIKey | YXIOOKUHUJQKRZ-MQFOKRINSA-N |
| XLogP | 0.19 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|