C22H35NO5S2 — CID 143686040
6-(hydroxymethyl)-4-methoxy-5-methyl-2-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxan-3-ol;methylcyclobutane (PubChem CID 143686040) has the molecular formula C22H35NO5S2 and a molecular weight of 457.66 g/mol. Its IUPAC name is 6-(hydroxymethyl)-4-methoxy-5-methyl-2-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxan-3-ol;methylcyclobutane.
| Compound Name | 6-(hydroxymethyl)-4-methoxy-5-methyl-2-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxan-3-ol;methylcyclobutane |
|---|---|
| PubChem CID | 143686040 |
| Molecular Formula | C22H35NO5S2 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 6-(hydroxymethyl)-4-methoxy-5-methyl-2-[2-(pyridin-2-yldisulfanyl)but-3-enoxy]oxan-3-ol;methylcyclobutane |
| SMILES | C=CC(COC1OC(CO)C(C)C(OC)C1O)SSc1ccccn1.CC1CCC1 |
| InChI | InChI=1S/C17H25NO5S2.C5H10/c1-4-12(24-25-14-7-5-6-8-18-14)10-22-17-15(20)16(21-3)11(2)13(9-19)23-17;1-5-3-2-4-5/h4-8,11-13,15-17,19-20H,1,9-10H2,2-3H3;5H,2-4H2,1H3 |
| InChIKey | SZBAJGJZZDMBKU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|