C22H21NO6 — CID 140532712
(2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2-indeno[1,2-b]indol-10-yloxy-5-methoxyoxane-3,4-diol (PubChem CID 140532712) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2-indeno[1,2-b]indol-10-yloxy-5-methoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2-indeno[1,2-b]indol-10-yloxy-5-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 140532712 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (2R,3R,4R,5S,6R)-6-(hydroxymethyl)-2-indeno[1,2-b]indol-10-yloxy-5-methoxyoxane-3,4-diol |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O)[C@@H](OC2=c3ccccc3=C3N=c4ccccc4=C32)O[C@@H]1CO |
| InChI | InChI=1S/C22H21NO6/c1-27-21-15(10-24)28-22(19(26)18(21)25)29-20-12-7-3-2-6-11(12)17-16(20)13-8-4-5-9-14(13)23-17/h2-9,15,18-19,21-22,24-26H,10H2,1H3/t15-,18-,19-,21-,22-/m1/s1 |
| InChIKey | XJPWTIFEPDCSIX-AJKNULPHSA-N |
| XLogP | -2.13 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |