C18H22N2O5 — CID 90773161
[(2R,3S,4S,5S)-5-methoxy-3,4-bis(pyridin-2-ylmethoxy)oxolan-2-yl]methanol (PubChem CID 90773161) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-5-methoxy-3,4-bis(pyridin-2-ylmethoxy)oxolan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5S)-5-methoxy-3,4-bis(pyridin-2-ylmethoxy)oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 90773161 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [(2R,3S,4S,5S)-5-methoxy-3,4-bis(pyridin-2-ylmethoxy)oxolan-2-yl]methanol |
| SMILES | CO[C@H]1O[C@H](CO)[C@H](OCc2ccccn2)[C@@H]1OCc1ccccn1 |
| InChI | InChI=1S/C18H22N2O5/c1-22-18-17(24-12-14-7-3-5-9-20-14)16(15(10-21)25-18)23-11-13-6-2-4-8-19-13/h2-9,15-18,21H,10-12H2,1H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | DUWHZFYVDLXRBQ-OWSLCNJRSA-N |
| XLogP | 1.31 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |